C44H37NO8 — CID 5065859
2-(4-acetylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5065859) has the molecular formula C44H37NO8 and a molecular weight of 707.78 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-acetylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5065859 |
| Molecular Formula | C44H37NO8 |
| Molecular Weight | 707.78 g/mol |
| Exact Mass | 707.25 |
| IUPAC Name | 2-(4-acetylphenyl)-6-(4-hydroxy-3,5-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(C(C)=O)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C44H37NO8/c1-24(46)25-14-16-29(17-15-25)45-42(50)31-19-18-30-33(38(31)43(45)51)22-34-40(48)32(26-10-6-4-7-11-26)23-37(47)44(34,28-12-8-5-9-13-28)39(30)27-20-35(52-2)41(49)36(21-27)53-3/h4-18,20-21,23,31,33-34,38-39,49H,19,22H2,1-3H3 |
| InChIKey | UOKRHXDZDRNTMZ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|