C42H34N2O9 — CID 4638598
6-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4638598) has the molecular formula C42H34N2O9 and a molecular weight of 710.74 g/mol. Its IUPAC name is 6-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4638598 |
| Molecular Formula | C42H34N2O9 |
| Molecular Weight | 710.74 g/mol |
| Exact Mass | 710.23 |
| IUPAC Name | 6-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-nitrophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cccc([N+](=O)[O-])c5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C42H34N2O9/c1-52-33-18-24(19-34(53-2)39(33)47)37-28-16-17-29-36(41(49)43(40(29)48)26-14-9-15-27(20-26)44(50)51)31(28)21-32-38(46)30(23-10-5-3-6-11-23)22-35(45)42(32,37)25-12-7-4-8-13-25/h3-16,18-20,22,29,31-32,36-37,47H,17,21H2,1-2H3 |
| InChIKey | PEUYZEIPDQEZJW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|