C43H34BrNO7 — CID 3299435
2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3299435) has the molecular formula C43H34BrNO7 and a molecular weight of 756.65 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3299435 |
| Molecular Formula | C43H34BrNO7 |
| Molecular Weight | 756.65 g/mol |
| Exact Mass | 755.15 |
| IUPAC Name | 2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(C(C)=O)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C43H34BrNO7/c1-23(46)24-13-15-28(16-14-24)45-41(50)30-18-17-29-32(37(30)42(45)51)21-33-39(48)31(25-9-5-3-6-10-25)22-36(47)43(33,27-11-7-4-8-12-27)38(29)26-19-34(44)40(49)35(20-26)52-2/h3-17,19-20,22,30,32-33,37-38,49H,18,21H2,1-2H3 |
| InChIKey | GYAJLVYPCSTSMJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.65 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|