C41H32BrClN2O7 — CID 3316237
2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3316237) has the molecular formula C41H32BrClN2O7 and a molecular weight of 780.07 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3316237 |
| Molecular Formula | C41H32BrClN2O7 |
| Molecular Weight | 780.07 g/mol |
| Exact Mass | 778.11 |
| IUPAC Name | 2-(4-acetylphenyl)-6-(3-bromo-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(C(C)=O)cc5)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C41H32BrClN2O7/c1-21(46)22-11-13-26(14-12-22)44-37(48)29-16-15-28-30(34(29)39(44)50)20-31-38(49)45(27-10-6-9-25(43)19-27)40(51)41(31,24-7-4-3-5-8-24)35(28)23-17-32(42)36(47)33(18-23)52-2/h3-15,17-19,29-31,34-35,47H,16,20H2,1-2H3 |
| InChIKey | WFDGEOXHYCTSKQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.07 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|