C47H37ClN2O8 — CID 3587855
2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3587855) has the molecular formula C47H37ClN2O8 and a molecular weight of 793.27 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3587855 |
| Molecular Formula | C47H37ClN2O8 |
| Molecular Weight | 793.27 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | 2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)c(C2C3=CCC4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C47H37ClN2O8/c1-57-32-23-37(51)40(38(24-32)58-2)41-33-20-21-34-39(45(55)49(43(34)53)30-18-16-27(17-19-30)42(52)26-10-5-3-6-11-26)35(33)25-36-44(54)50(31-15-9-14-29(48)22-31)46(56)47(36,41)28-12-7-4-8-13-28/h3-20,22-24,34-36,39,41,51H,21,25H2,1-2H3 |
| InChIKey | ONCAFPLFORHPLP-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.27 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|