C35H31ClN2O7 — CID 3617319
8-(3-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3617319) has the molecular formula C35H31ClN2O7 and a molecular weight of 627.09 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3617319 |
| Molecular Formula | C35H31ClN2O7 |
| Molecular Weight | 627.09 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | 8-(3-chlorophenyl)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2-methyl-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCC3C(=O)N(C)C(=O)C3C2CC2C(=O)N(c3cccc(Cl)c3)C(=O)C21c1ccccc1 |
| InChI | InChI=1S/C35H31ClN2O7/c1-37-31(40)23-13-12-22-24(28(23)33(37)42)17-25-32(41)38(20-11-7-10-19(36)14-20)34(43)35(25,18-8-5-4-6-9-18)30(22)29-26(44-2)15-21(39)16-27(29)45-3/h4-12,14-16,23-25,28,30,39H,13,17H2,1-3H3 |
| InChIKey | ZFNCCXUYEWWAKS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.09 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|