C33H27ClN2O7 — CID 4079985
8-(3-chlorophenyl)-2-hydroxy-6-(2-hydroxy-4-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4079985) has the molecular formula C33H27ClN2O7 and a molecular weight of 599.04 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-2-hydroxy-6-(2-hydroxy-4-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-2-hydroxy-6-(2-hydroxy-4-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4079985 |
| Molecular Formula | C33H27ClN2O7 |
| Molecular Weight | 599.04 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 8-(3-chlorophenyl)-2-hydroxy-6-(2-hydroxy-4-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C33H27ClN2O7/c1-43-20-10-11-22(26(37)15-20)28-21-12-13-23-27(31(40)36(42)29(23)38)24(21)16-25-30(39)35(19-9-5-8-18(34)14-19)32(41)33(25,28)17-6-3-2-4-7-17/h2-12,14-15,23-25,27-28,37,42H,13,16H2,1H3 |
| InChIKey | FWMCQRQQKBLNGD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.04 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|