C33H26ClIN2O7 — CID 3318944
8-(3-chlorophenyl)-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3318944) has the molecular formula C33H26ClIN2O7 and a molecular weight of 724.94 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3318944 |
| Molecular Formula | C33H26ClIN2O7 |
| Molecular Weight | 724.94 g/mol |
| Exact Mass | 724.05 |
| IUPAC Name | 8-(3-chlorophenyl)-2-hydroxy-6-(4-hydroxy-3-iodo-5-methoxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)cc(I)c1O |
| InChI | InChI=1S/C33H26ClIN2O7/c1-44-25-13-16(12-24(35)28(25)38)27-20-10-11-21-26(31(41)37(43)29(21)39)22(20)15-23-30(40)36(19-9-5-8-18(34)14-19)32(42)33(23,27)17-6-3-2-4-7-17/h2-10,12-14,21-23,26-27,38,43H,11,15H2,1H3 |
| InChIKey | HMKKFWAXOACSQW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|