C36H30Cl2N2O8 — CID 4195011
3-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 4195011) has the molecular formula C36H30Cl2N2O8 and a molecular weight of 689.55 g/mol. Its IUPAC name is 3-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 4195011 |
| Molecular Formula | C36H30Cl2N2O8 |
| Molecular Weight | 689.55 g/mol |
| Exact Mass | 688.14 |
| IUPAC Name | 3-[6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)cc(Cl)c1O |
| InChI | InChI=1S/C36H30Cl2N2O8/c1-48-27-15-18(14-26(38)31(27)43)30-22-10-11-23-29(34(46)39(32(23)44)13-12-28(41)42)24(22)17-25-33(45)40(21-9-5-8-20(37)16-21)35(47)36(25,30)19-6-3-2-4-7-19/h2-10,14-16,23-25,29-30,43H,11-13,17H2,1H3,(H,41,42) |
| InChIKey | IGLRYAOMKSTMFU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|