C49H39NO8 — CID 5098156
2-(4-benzoylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5098156) has the molecular formula C49H39NO8 and a molecular weight of 769.85 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5098156 |
| Molecular Formula | C49H39NO8 |
| Molecular Weight | 769.85 g/mol |
| Exact Mass | 769.27 |
| IUPAC Name | 2-(4-benzoylphenyl)-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)c(C2C3=CCC4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C49H39NO8/c1-57-33-24-39(51)43(40(25-33)58-2)44-34-22-23-35-42(48(56)50(47(35)55)32-20-18-30(19-21-32)45(53)29-14-8-4-9-15-29)37(34)26-38-46(54)36(28-12-6-3-7-13-28)27-41(52)49(38,44)31-16-10-5-11-17-31/h3-22,24-25,27,35,37-38,42,44,51H,23,26H2,1-2H3 |
| InChIKey | LTSGVUNDXDRMLV-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.85 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|