C47H38N2O6 — CID 3483452
2-(4-anilinophenyl)-6-(2-hydroxy-6-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3483452) has the molecular formula C47H38N2O6 and a molecular weight of 726.83 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6-(2-hydroxy-6-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6-(2-hydroxy-6-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3483452 |
| Molecular Formula | C47H38N2O6 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.27 |
| IUPAC Name | 2-(4-anilinophenyl)-6-(2-hydroxy-6-methoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C47H38N2O6/c1-55-39-19-11-18-38(50)42(39)43-33-24-25-34-41(46(54)49(45(34)53)32-22-20-31(21-23-32)48-30-16-9-4-10-17-30)36(33)26-37-44(52)35(28-12-5-2-6-13-28)27-40(51)47(37,43)29-14-7-3-8-15-29/h2-24,27,34,36-37,41,43,48,50H,25-26H2,1H3 |
| InChIKey | FJVKCGPFFVAZDK-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|