C48H40N2O6 — CID 3293407
2-(4-anilinophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3293407) has the molecular formula C48H40N2O6 and a molecular weight of 740.86 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3293407 |
| Molecular Formula | C48H40N2O6 |
| Molecular Weight | 740.86 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 2-(4-anilinophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(c5ccc(Nc6ccccc6)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C48H40N2O6/c1-2-56-40-20-12-19-36(45(40)53)43-34-25-26-35-42(47(55)50(46(35)54)33-23-21-32(22-24-33)49-31-17-10-5-11-18-31)38(34)27-39-44(52)37(29-13-6-3-7-14-29)28-41(51)48(39,43)30-15-8-4-9-16-30/h3-25,28,35,38-39,42-43,49,53H,2,26-27H2,1H3 |
| InChIKey | ZLKWYEICIRPUAV-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|