C42H34ClNO6 — CID 6660392
(3aS,6R,6aS,10aR,11aS,11bR)-2-(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6660392) has the molecular formula C42H34ClNO6 and a molecular weight of 684.19 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-2-(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6660392 |
| Molecular Formula | C42H34ClNO6 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-(4-chlorophenyl)-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCOc1cccc([C@H]2C3=CC[C@@H]4C(=O)N(c5ccc(Cl)cc5)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]23c2ccccc2)c1O |
| InChI | InChI=1S/C42H34ClNO6/c1-2-50-34-15-9-14-30(39(34)47)37-28-20-21-29-36(41(49)44(40(29)48)27-18-16-26(43)17-19-27)32(28)22-33-38(46)31(24-10-5-3-6-11-24)23-35(45)42(33,37)25-12-7-4-8-13-25/h3-20,23,29,32-33,36-37,47H,2,21-22H2,1H3/t29-,32+,33-,36-,37+,42-/m0/s1 |
| InChIKey | OYRARUQDNPUUIH-HDANZFSHSA-N |
| XLogP | 7.47 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|