C43H37NO6 — CID 6660383
(3aS,6R,6aS,10aR,11aS,11bR)-2-benzyl-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6660383) has the molecular formula C43H37NO6 and a molecular weight of 663.77 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-2-benzyl-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-benzyl-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6660383 |
| Molecular Formula | C43H37NO6 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-benzyl-6-(3-ethoxy-2-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCOc1cccc([C@H]2C3=CC[C@@H]4C(=O)N(Cc5ccccc5)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]23c2ccccc2)c1O |
| InChI | InChI=1S/C43H37NO6/c1-2-50-35-20-12-19-31(40(35)47)38-29-21-22-30-37(42(49)44(41(30)48)25-26-13-6-3-7-14-26)33(29)23-34-39(46)32(27-15-8-4-9-16-27)24-36(45)43(34,38)28-17-10-5-11-18-28/h3-21,24,30,33-34,37-38,47H,2,22-23,25H2,1H3/t30-,33+,34-,37-,38+,43-/m0/s1 |
| InChIKey | KSPUESLWJMMDLA-VBXHQPPCSA-N |
| XLogP | 6.82 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|