C40H33NO6S — CID 5099331
6-(2-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5099331) has the molecular formula C40H33NO6S and a molecular weight of 655.77 g/mol. Its IUPAC name is 6-(2-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(2-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5099331 |
| Molecular Formula | C40H33NO6S |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.20 |
| IUPAC Name | 6-(2-hydroxy-4-methoxyphenyl)-6a,9-diphenyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(Cc5cccs5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C40H33NO6S/c1-47-25-14-15-28(33(42)19-25)36-27-16-17-29-35(39(46)41(38(29)45)22-26-13-8-18-48-26)31(27)20-32-37(44)30(23-9-4-2-5-10-23)21-34(43)40(32,36)24-11-6-3-7-12-24/h2-16,18-19,21,29,31-32,35-36,42H,17,20,22H2,1H3 |
| InChIKey | WLGISAIZCQRFAI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|