C37H31NO8 — CID 6660427
methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6660427) has the molecular formula C37H31NO8 and a molecular weight of 617.65 g/mol. Its IUPAC name is methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6660427 |
| Molecular Formula | C37H31NO8 |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C(c4ccccc4)=CC(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(OC)cc2O)C1=O |
| InChI | InChI=1S/C37H31NO8/c1-45-22-13-14-24(29(39)17-22)32-23-15-16-25-31(35(43)38(34(25)42)36(44)46-2)27(23)18-28-33(41)26(20-9-5-3-6-10-20)19-30(40)37(28,32)21-11-7-4-8-12-21/h3-15,17,19,25,27-28,31-32,39H,16,18H2,1-2H3/t25-,27+,28-,31-,32+,37-/m0/s1 |
| InChIKey | OLINOSQNDCWXEQ-KGXGLSFFSA-N |
| XLogP | 4.99 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|