C37H31NO7 — CID 6660655
methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6660655) has the molecular formula C37H31NO7 and a molecular weight of 601.66 g/mol. Its IUPAC name is methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6660655 |
| Molecular Formula | C37H31NO7 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-methylphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C(c4ccccc4)=CC(=O)[C@@]2(c2ccccc2)[C@H]3c2cccc(C)c2O)C1=O |
| InChI | InChI=1S/C37H31NO7/c1-20-10-9-15-25(32(20)40)31-23-16-17-24-30(35(43)38(34(24)42)36(44)45-2)27(23)18-28-33(41)26(21-11-5-3-6-12-21)19-29(39)37(28,31)22-13-7-4-8-14-22/h3-16,19,24,27-28,30-31,40H,17-18H2,1-2H3/t24-,27+,28-,30-,31+,37-/m0/s1 |
| InChIKey | QIZLMOHBRKLRDN-BGYVYFFDSA-N |
| XLogP | 5.29 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|