C40H35NO9 — CID 3578163
methyl 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 3578163) has the molecular formula C40H35NO9 and a molecular weight of 673.72 g/mol. Its IUPAC name is methyl 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3578163 |
| Molecular Formula | C40H35NO9 |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 673.23 |
| IUPAC Name | methyl 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)C(c5ccccc5)=CC(=O)C4(c4ccccc4)C3C=Cc3cc(OC)c(O)c(OC)c3)C2C1=O |
| InChI | InChI=1S/C40H35NO9/c1-48-31-18-22(19-32(49-2)36(31)44)14-17-29-25-15-16-26-34(38(46)41(37(26)45)39(47)50-3)28(25)20-30-35(43)27(23-10-6-4-7-11-23)21-33(42)40(29,30)24-12-8-5-9-13-24/h4-15,17-19,21,26,28-30,34,44H,16,20H2,1-3H3 |
| InChIKey | CQWRCEKVXBEDKK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|