C42H39NO9 — CID 4218688
4-[6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 4218688) has the molecular formula C42H39NO9 and a molecular weight of 701.77 g/mol. Its IUPAC name is 4-[6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4218688 |
| Molecular Formula | C42H39NO9 |
| Molecular Weight | 701.77 g/mol |
| Exact Mass | 701.26 |
| IUPAC Name | 4-[6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(CCCC(=O)O)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C23c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C42H39NO9/c1-51-33-20-24(21-34(52-2)39(33)48)15-18-31-27-16-17-28-37(41(50)43(40(28)49)19-9-14-36(45)46)30(27)22-32-38(47)29(25-10-5-3-6-11-25)23-35(44)42(31,32)26-12-7-4-8-13-26/h3-8,10-13,15-16,18,20-21,23,28,30-32,37,48H,9,14,17,19,22H2,1-2H3,(H,45,46) |
| InChIKey | KXWSYSYNULKEAB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.77 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|