C46H41NO8 — CID 4287609
6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4287609) has the molecular formula C46H41NO8 and a molecular weight of 735.83 g/mol. Its IUPAC name is 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4287609 |
| Molecular Formula | C46H41NO8 |
| Molecular Weight | 735.83 g/mol |
| Exact Mass | 735.28 |
| IUPAC Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(CCc5ccc(O)cc5)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C23c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C46H41NO8/c1-54-38-23-28(24-39(55-2)43(38)51)15-20-36-32-18-19-33-41(45(53)47(44(33)52)22-21-27-13-16-31(48)17-14-27)35(32)25-37-42(50)34(29-9-5-3-6-10-29)26-40(49)46(36,37)30-11-7-4-8-12-30/h3-18,20,23-24,26,33,35-37,41,48,51H,19,21-22,25H2,1-2H3 |
| InChIKey | KQQBQNVETAJZCT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.83 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|