C39H34N2O8 — CID 4161137
6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 4161137) has the molecular formula C39H34N2O8 and a molecular weight of 658.71 g/mol. Its IUPAC name is 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4161137 |
| Molecular Formula | C39H34N2O8 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C23c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C39H34N2O8/c1-48-30-17-21(18-31(49-2)35(30)44)13-16-28-24-14-15-25-33(37(46)41(36(25)45)38(40)47)27(24)19-29-34(43)26(22-9-5-3-6-10-22)20-32(42)39(28,29)23-11-7-4-8-12-23/h3-14,16-18,20,25,27-29,33,44H,15,19H2,1-2H3,(H2,40,47) |
| InChIKey | SZZUZQVVFKKBJD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|