C35H28N2O6 — CID 3281978
6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 3281978) has the molecular formula C35H28N2O6 and a molecular weight of 572.62 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | 6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 3281978 |
| Molecular Formula | C35H28N2O6 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 6-(4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | NC(=O)N1C(=O)C2CC=C3C(CC4C(=O)C(c5ccccc5)=CC(=O)C4(c4ccccc4)C3c3ccc(O)cc3)C2C1=O |
| InChI | InChI=1S/C35H28N2O6/c36-34(43)37-32(41)24-16-15-23-26(29(24)33(37)42)17-27-31(40)25(19-7-3-1-4-8-19)18-28(39)35(27,21-9-5-2-6-10-21)30(23)20-11-13-22(38)14-12-20/h1-15,18,24,26-27,29-30,38H,16-17H2,(H2,36,43) |
| InChIKey | YDIBXHRDARBIFX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|