C37H32N2O7 — CID 5128672
6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 5128672) has the molecular formula C37H32N2O7 and a molecular weight of 616.67 g/mol. Its IUPAC name is 6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | 6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 5128672 |
| Molecular Formula | C37H32N2O7 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 6-(3-ethoxy-4-hydroxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C37H32N2O7/c1-2-46-29-17-21(13-16-28(29)40)32-23-14-15-24-31(35(44)39(34(24)43)36(38)45)26(23)18-27-33(42)25(20-9-5-3-6-10-20)19-30(41)37(27,32)22-11-7-4-8-12-22/h3-14,16-17,19,24,26-27,31-32,40H,2,15,18H2,1H3,(H2,38,45) |
| InChIKey | UCEUQAINFCGASE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|