C37H33NO5 — CID 6661027
(3aS,6R,6aS,10aR,11aS,11bR)-2-ethyl-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6661027) has the molecular formula C37H33NO5 and a molecular weight of 571.67 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-2-ethyl-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-ethyl-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6661027 |
| Molecular Formula | C37H33NO5 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-ethyl-6-(4-hydroxy-3-methylphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C(c4ccccc4)=CC(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(O)c(C)c2)C1=O |
| InChI | InChI=1S/C37H33NO5/c1-3-38-35(42)26-16-15-25-28(32(26)36(38)43)19-29-34(41)27(22-10-6-4-7-11-22)20-31(40)37(29,24-12-8-5-9-13-24)33(25)23-14-17-30(39)21(2)18-23/h4-15,17-18,20,26,28-29,32-33,39H,3,16,19H2,1-2H3/t26-,28+,29-,32-,33-,37-/m0/s1 |
| InChIKey | DZZJTEVXYIAMRX-FQNDJIRSSA-N |
| XLogP | 5.54 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|