C35H31NO6 — CID 6661521
(3aS,6S,6aS,10aR,11aS,11bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6661521) has the molecular formula C35H31NO6 and a molecular weight of 561.63 g/mol. Its IUPAC name is (3aS,6S,6aS,10aR,11aS,11bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,6aS,10aR,11aS,11bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6661521 |
| Molecular Formula | C35H31NO6 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | (3aS,6S,6aS,10aR,11aS,11bR)-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C(c4ccccc4)=CC(=O)[C@@]2(c2ccccc2)[C@H]3c2ccc(CO)o2)C1=O |
| InChI | InChI=1S/C35H31NO6/c1-2-36-33(40)24-15-14-23-26(30(24)34(36)41)17-27-32(39)25(20-9-5-3-6-10-20)18-29(38)35(27,21-11-7-4-8-12-21)31(23)28-16-13-22(19-37)42-28/h3-14,16,18,24,26-27,30-31,37H,2,15,17,19H2,1H3/t24-,26+,27-,30-,31+,35-/m0/s1 |
| InChIKey | COXZUPZEYSXVHN-IAIRJUIPSA-N |
| XLogP | 4.62 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|