C33H27NO6 — CID 3293389
6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3293389) has the molecular formula C33H27NO6 and a molecular weight of 533.58 g/mol. Its IUPAC name is 6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3293389 |
| Molecular Formula | C33H27NO6 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 6-[5-(hydroxymethyl)furan-2-yl]-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1NC(=O)C2C1CC=C1C2CC2C(=O)C(c3ccccc3)=CC(=O)C2(c2ccccc2)C1c1ccc(CO)o1 |
| InChI | InChI=1S/C33H27NO6/c35-17-20-11-14-26(40-20)29-21-12-13-22-28(32(39)34-31(22)38)24(21)15-25-30(37)23(18-7-3-1-4-8-18)16-27(36)33(25,29)19-9-5-2-6-10-19/h1-12,14,16,22,24-25,28-29,35H,13,15,17H2,(H,34,38,39) |
| InChIKey | XFASDWAZSOCLFQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|