C37H29N3O6 — CID 6640926
(2S,3S,8R,10R)-2-[5-(hydroxymethyl)furan-2-yl]-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6640926) has the molecular formula C37H29N3O6 and a molecular weight of 611.65 g/mol. Its IUPAC name is (2S,3S,8R,10R)-2-[5-(hydroxymethyl)furan-2-yl]-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2S,3S,8R,10R)-2-[5-(hydroxymethyl)furan-2-yl]-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6640926 |
| Molecular Formula | C37H29N3O6 |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | (2S,3S,8R,10R)-2-[5-(hydroxymethyl)furan-2-yl]-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)[C@@]2(c3ccccc3)[C@@H](c3ccc(CO)o3)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C37H29N3O6/c41-22-26-16-17-31(46-26)33-27-18-19-38-35(44)39(25-14-8-3-9-15-25)36(45)40(38)30(27)21-29-34(43)28(23-10-4-1-5-11-23)20-32(42)37(29,33)24-12-6-2-7-13-24/h1-18,20,29-30,33,41H,19,21-22H2/t29-,30+,33+,37-/m0/s1 |
| InChIKey | QAGNIKCCBVVDRL-NYGWVSAZSA-N |
| XLogP | 4.34 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|