C40H33N3O7 — CID 6640842
(2R,3S,8R,10R)-2-(2-hydroxy-4,6-dimethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6640842) has the molecular formula C40H33N3O7 and a molecular weight of 667.72 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(2-hydroxy-4,6-dimethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(2-hydroxy-4,6-dimethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6640842 |
| Molecular Formula | C40H33N3O7 |
| Molecular Weight | 667.72 g/mol |
| Exact Mass | 667.23 |
| IUPAC Name | (2R,3S,8R,10R)-2-(2-hydroxy-4,6-dimethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | COc1cc(O)c([C@H]2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]23c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C40H33N3O7/c1-49-27-20-32(44)35(33(21-27)50-2)36-28-18-19-41-38(47)42(26-16-10-5-11-17-26)39(48)43(41)31(28)23-30-37(46)29(24-12-6-3-7-13-24)22-34(45)40(30,36)25-14-8-4-9-15-25/h3-18,20-22,30-31,36,44H,19,23H2,1-2H3/t30-,31+,36+,40-/m0/s1 |
| InChIKey | KVOUUBRWTNOMBU-MTCNOOPNSA-N |
| XLogP | 4.98 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|