C39H31N3O6 — CID 4088952
2-(4-hydroxy-2-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 4088952) has the molecular formula C39H31N3O6 and a molecular weight of 637.69 g/mol. Its IUPAC name is 2-(4-hydroxy-2-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | 2-(4-hydroxy-2-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 4088952 |
| Molecular Formula | C39H31N3O6 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | 2-(4-hydroxy-2-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCn3c(=O)n(-c4ccccc4)c(=O)n3C2CC2C(=O)C(c3ccccc3)=CC(=O)C21c1ccccc1 |
| InChI | InChI=1S/C39H31N3O6/c1-48-33-21-27(43)17-18-29(33)35-28-19-20-40-37(46)41(26-15-9-4-10-16-26)38(47)42(40)32(28)23-31-36(45)30(24-11-5-2-6-12-24)22-34(44)39(31,35)25-13-7-3-8-14-25/h2-19,21-22,31-32,35,43H,20,23H2,1H3 |
| InChIKey | LSPUSIBUDVAGAA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|