C35H31N3O7 — CID 6640901
(2S,3S,8R,10R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6640901) has the molecular formula C35H31N3O7 and a molecular weight of 605.65 g/mol. Its IUPAC name is (2S,3S,8R,10R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2S,3S,8R,10R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6640901 |
| Molecular Formula | C35H31N3O7 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | (2S,3S,8R,10R)-2-(4-hydroxy-3,5-dimethoxyphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | COc1cc([C@H]2C3=CCn4c(=O)n(C)c(=O)n4[C@@H]3C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]23c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C35H31N3O7/c1-36-33(42)37-15-14-23-26(38(37)34(36)43)19-25-31(40)24(20-10-6-4-7-11-20)18-29(39)35(25,22-12-8-5-9-13-22)30(23)21-16-27(44-2)32(41)28(17-21)45-3/h4-14,16-18,25-26,30,41H,15,19H2,1-3H3/t25-,26+,30-,35-/m0/s1 |
| InChIKey | AWDGKXWROGKXMR-SBTRJMSTSA-N |
| XLogP | 3.53 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|