C35H31N3O5 — CID 4571454
2-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 4571454) has the molecular formula C35H31N3O5 and a molecular weight of 573.65 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | 2-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 4571454 |
| Molecular Formula | C35H31N3O5 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethylphenyl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | Cc1cc(C2C3=CCn4c(=O)n(C)c(=O)n4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C35H31N3O5/c1-20-16-23(17-21(2)31(20)40)30-25-14-15-37-33(42)36(3)34(43)38(37)28(25)19-27-32(41)26(22-10-6-4-7-11-22)18-29(39)35(27,30)24-12-8-5-9-13-24/h4-14,16-18,27-28,30,40H,15,19H2,1-3H3 |
| InChIKey | XHBDLARTXXBMTF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|