C45H35N3O6 — CID 6640866
(2R,3S,8R,10R)-2-(2-hydroxy-4-phenylmethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6640866) has the molecular formula C45H35N3O6 and a molecular weight of 713.79 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(2-hydroxy-4-phenylmethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(2-hydroxy-4-phenylmethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6640866 |
| Molecular Formula | C45H35N3O6 |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 713.25 |
| IUPAC Name | (2R,3S,8R,10R)-2-(2-hydroxy-4-phenylmethoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)[C@@]2(c3ccccc3)[C@@H](c3ccc(OCc4ccccc4)cc3O)C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C45H35N3O6/c49-39-25-33(54-28-29-13-5-1-6-14-29)21-22-35(39)41-34-23-24-46-43(52)47(32-19-11-4-12-20-32)44(53)48(46)38(34)27-37-42(51)36(30-15-7-2-8-16-30)26-40(50)45(37,41)31-17-9-3-10-18-31/h1-23,25-26,37-38,41,49H,24,27-28H2/t37-,38+,41+,45-/m0/s1 |
| InChIKey | MXMKVPASCWQRQO-PBUWGAOISA-N |
| XLogP | 6.54 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|