C39H30BrN3O6 — CID 6640854
(2R,3S,8R,10R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6640854) has the molecular formula C39H30BrN3O6 and a molecular weight of 716.59 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6640854 |
| Molecular Formula | C39H30BrN3O6 |
| Molecular Weight | 716.59 g/mol |
| Exact Mass | 715.13 |
| IUPAC Name | (2R,3S,8R,10R)-2-(5-bromo-2-hydroxy-3-methoxyphenyl)-3,6,13-triphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | COc1cc(Br)cc([C@H]2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]23c2ccccc2)c1O |
| InChI | InChI=1S/C39H30BrN3O6/c1-49-32-20-25(40)19-29(36(32)46)34-27-17-18-41-37(47)42(26-15-9-4-10-16-26)38(48)43(41)31(27)22-30-35(45)28(23-11-5-2-6-12-23)21-33(44)39(30,34)24-13-7-3-8-14-24/h2-17,19-21,30-31,34,46H,18,22H2,1H3/t30-,31+,34+,39-/m0/s1 |
| InChIKey | XCTRDDXOWSFFMF-JYVJKDMGSA-N |
| XLogP | 5.74 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|