C38H32BrN5O6 — CID 4112092
10-(5-bromo-2-hydroxy-3-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4112092) has the molecular formula C38H32BrN5O6 and a molecular weight of 734.61 g/mol. Its IUPAC name is 10-(5-bromo-2-hydroxy-3-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 10-(5-bromo-2-hydroxy-3-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4112092 |
| Molecular Formula | C38H32BrN5O6 |
| Molecular Weight | 734.61 g/mol |
| Exact Mass | 733.15 |
| IUPAC Name | 10-(5-bromo-2-hydroxy-3-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cc(Br)cc(C2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C38H32BrN5O6/c1-22-13-15-25(16-14-22)40-43-34(46)29-21-30-27(17-18-41-36(48)42(37(49)44(30)41)26-11-7-4-8-12-26)32(28-19-24(39)20-31(50-2)33(28)45)38(29,35(43)47)23-9-5-3-6-10-23/h3-17,19-20,29-30,32,40,45H,18,21H2,1-2H3 |
| InChIKey | FJNDKGIGALNRIH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|