C39H35N5O6 — CID 3453676
10-(3-ethoxy-2-hydroxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 3453676) has the molecular formula C39H35N5O6 and a molecular weight of 669.74 g/mol. Its IUPAC name is 10-(3-ethoxy-2-hydroxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 10-(3-ethoxy-2-hydroxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 3453676 |
| Molecular Formula | C39H35N5O6 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | 10-(3-ethoxy-2-hydroxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | CCOc1cccc(C2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4C3CC3C(=O)N(Nc4ccc(C)cc4)C(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C39H35N5O6/c1-3-50-32-16-10-15-29(34(32)45)33-28-21-22-41-37(48)42(27-13-8-5-9-14-27)38(49)44(41)31(28)23-30-35(46)43(40-26-19-17-24(2)18-20-26)36(47)39(30,33)25-11-6-4-7-12-25/h4-21,30-31,33,40,45H,3,22-23H2,1-2H3 |
| InChIKey | IIHHHXKDCOZOSB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|