C38H33N5O6 — CID 6640131
(1R,10R,11S,15R)-10-(2-hydroxy-4-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640131) has the molecular formula C38H33N5O6 and a molecular weight of 655.71 g/mol. Its IUPAC name is (1R,10R,11S,15R)-10-(2-hydroxy-4-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-10-(2-hydroxy-4-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640131 |
| Molecular Formula | C38H33N5O6 |
| Molecular Weight | 655.71 g/mol |
| Exact Mass | 655.24 |
| IUPAC Name | (1R,10R,11S,15R)-10-(2-hydroxy-4-methoxyphenyl)-13-(4-methylanilino)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1ccc([C@H]2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@H]3C(=O)N(Nc4ccc(C)cc4)C(=O)[C@@]23c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C38H33N5O6/c1-23-13-15-25(16-14-23)39-42-34(45)30-22-31-28(19-20-40-36(47)41(37(48)43(31)40)26-11-7-4-8-12-26)33(29-18-17-27(49-2)21-32(29)44)38(30,35(42)46)24-9-5-3-6-10-24/h3-19,21,30-31,33,39,44H,20,22H2,1-2H3/t30-,31+,33+,38+/m0/s1 |
| InChIKey | MEMMSCCLGFKHDQ-KOLWJJANSA-N |
| XLogP | 4.44 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|