C38H31ClFN5O7 — CID 4130540
11-(4-chlorophenyl)-13-(4-fluoroanilino)-10-(4-hydroxy-2,6-dimethoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4130540) has the molecular formula C38H31ClFN5O7 and a molecular weight of 724.15 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-13-(4-fluoroanilino)-10-(4-hydroxy-2,6-dimethoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 11-(4-chlorophenyl)-13-(4-fluoroanilino)-10-(4-hydroxy-2,6-dimethoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4130540 |
| Molecular Formula | C38H31ClFN5O7 |
| Molecular Weight | 724.15 g/mol |
| Exact Mass | 723.19 |
| IUPAC Name | 11-(4-chlorophenyl)-13-(4-fluoroanilino)-10-(4-hydroxy-2,6-dimethoxyphenyl)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cc(O)cc(OC)c1C1C2=CCn3c(=O)n(-c4ccccc4)c(=O)n3C2CC2C(=O)N(Nc3ccc(F)cc3)C(=O)C21c1ccc(Cl)cc1 |
| InChI | InChI=1S/C38H31ClFN5O7/c1-51-30-18-26(46)19-31(52-2)32(30)33-27-16-17-42-36(49)43(25-6-4-3-5-7-25)37(50)45(42)29(27)20-28-34(47)44(41-24-14-12-23(40)13-15-24)35(48)38(28,33)21-8-10-22(39)11-9-21/h3-16,18-19,28-29,33,41,46H,17,20H2,1-2H3 |
| InChIKey | VPPOZZNAEHJWOS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.15 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|