C36H26Cl2FN5O5 — CID 4622991
10-(2-chloro-4-hydroxyphenyl)-11-(4-chlorophenyl)-13-(4-fluoroanilino)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 4622991) has the molecular formula C36H26Cl2FN5O5 and a molecular weight of 698.54 g/mol. Its IUPAC name is 10-(2-chloro-4-hydroxyphenyl)-11-(4-chlorophenyl)-13-(4-fluoroanilino)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 10-(2-chloro-4-hydroxyphenyl)-11-(4-chlorophenyl)-13-(4-fluoroanilino)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 4622991 |
| Molecular Formula | C36H26Cl2FN5O5 |
| Molecular Weight | 698.54 g/mol |
| Exact Mass | 697.13 |
| IUPAC Name | 10-(2-chloro-4-hydroxyphenyl)-11-(4-chlorophenyl)-13-(4-fluoroanilino)-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=C1C2CC3C(=CCn4c(=O)n(-c5ccccc5)c(=O)n43)C(c3ccc(O)cc3Cl)C2(c2ccc(Cl)cc2)C(=O)N1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C36H26Cl2FN5O5/c37-21-8-6-20(7-9-21)36-28(32(46)43(33(36)47)40-23-12-10-22(39)11-13-23)19-30-27(31(36)26-15-14-25(45)18-29(26)38)16-17-41-34(48)42(35(49)44(30)41)24-4-2-1-3-5-24/h1-16,18,28,30-31,40,45H,17,19H2 |
| InChIKey | MEUWNACLLABQQV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|