C31H23Cl2FN4O5 — CID 6640641
(1R,10S,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-(2-chloro-4-hydroxyphenyl)-11-methyl-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640641) has the molecular formula C31H23Cl2FN4O5 and a molecular weight of 621.45 g/mol. Its IUPAC name is (1R,10S,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-(2-chloro-4-hydroxyphenyl)-11-methyl-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10S,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-(2-chloro-4-hydroxyphenyl)-11-methyl-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640641 |
| Molecular Formula | C31H23Cl2FN4O5 |
| Molecular Weight | 621.45 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | (1R,10S,11S,15R)-13-(3-chloro-4-fluorophenyl)-10-(2-chloro-4-hydroxyphenyl)-11-methyl-4-phenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | C[C@@]12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)[C@@H]1C[C@@H]1C(=CCn3c(=O)n(-c4ccccc4)c(=O)n31)[C@@H]2c1ccc(O)cc1Cl |
| InChI | InChI=1S/C31H23Cl2FN4O5/c1-31-21(27(40)36(28(31)41)17-7-10-24(34)23(33)13-17)15-25-20(26(31)19-9-8-18(39)14-22(19)32)11-12-35-29(42)37(30(43)38(25)35)16-5-3-2-4-6-16/h2-11,13-14,21,25-26,39H,12,15H2,1H3/t21-,25+,26-,31+/m0/s1 |
| InChIKey | BEUXUASZMDCBLE-MSSHVVPBSA-N |
| XLogP | 4.82 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|