C34H28N4O6 — CID 6640818
(1R,10R,11S,15R)-10-(6-hydroxy-4H-chromen-3-yl)-11-methyl-4,13-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640818) has the molecular formula C34H28N4O6 and a molecular weight of 588.62 g/mol. Its IUPAC name is (1R,10R,11S,15R)-10-(6-hydroxy-4H-chromen-3-yl)-11-methyl-4,13-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10R,11S,15R)-10-(6-hydroxy-4H-chromen-3-yl)-11-methyl-4,13-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640818 |
| Molecular Formula | C34H28N4O6 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | (1R,10R,11S,15R)-10-(6-hydroxy-4H-chromen-3-yl)-11-methyl-4,13-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | C[C@@]12C(=O)N(c3ccccc3)C(=O)[C@@H]1C[C@@H]1C(=CCn3c(=O)n(-c4ccccc4)c(=O)n31)[C@@H]2C1=COc2ccc(O)cc2C1 |
| InChI | InChI=1S/C34H28N4O6/c1-34-26(30(40)36(31(34)41)22-8-4-2-5-9-22)18-27-25(29(34)21-16-20-17-24(39)12-13-28(20)44-19-21)14-15-35-32(42)37(33(43)38(27)35)23-10-6-3-7-11-23/h2-14,17,19,26-27,29,39H,15-16,18H2,1H3/t26-,27+,29-,34+/m0/s1 |
| InChIKey | CAJVZFVFZBELFF-DDRNAOHYSA-N |
| XLogP | 3.72 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|