C31H24N6O6 — CID 6639384
(1S,10R)-10-(6-hydroxy-4H-chromen-3-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639384) has the molecular formula C31H24N6O6 and a molecular weight of 576.57 g/mol. Its IUPAC name is (1S,10R)-10-(6-hydroxy-4H-chromen-3-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1S,10R)-10-(6-hydroxy-4H-chromen-3-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639384 |
| Molecular Formula | C31H24N6O6 |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | (1S,10R)-10-(6-hydroxy-4H-chromen-3-yl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C[C@@H]1C(=CCn3c(=O)n(-c4ccccc4)c(=O)n31)[C@@H]2C1=COc2ccc(O)cc2C1 |
| InChI | InChI=1S/C31H24N6O6/c38-23-11-12-26-19(16-23)15-20(18-43-26)27-24-13-14-32-28(39)34(21-7-3-1-4-8-21)30(41)36(32)25(24)17-33-29(40)35(31(42)37(27)33)22-9-5-2-6-10-22/h1-13,16,18,25,27,38H,14-15,17H2/t25-,27+/m1/s1 |
| InChIKey | KWYYHUQUMNWMKZ-VPUSJEBWSA-N |
| XLogP | 1.88 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|