C29H24N6O6 — CID 6639273
(1S,10R)-10-(2-hydroxy-3-methoxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6639273) has the molecular formula C29H24N6O6 and a molecular weight of 552.55 g/mol. Its IUPAC name is (1S,10R)-10-(2-hydroxy-3-methoxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1S,10R)-10-(2-hydroxy-3-methoxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6639273 |
| Molecular Formula | C29H24N6O6 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | (1S,10R)-10-(2-hydroxy-3-methoxyphenyl)-4,13-diphenyl-2,4,6,11,13,15-hexazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cccc([C@H]2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3Cn3c(=O)n(-c4ccccc4)c(=O)n32)c1O |
| InChI | InChI=1S/C29H24N6O6/c1-41-23-14-8-13-21(25(23)36)24-20-15-16-30-26(37)32(18-9-4-2-5-10-18)28(39)34(30)22(20)17-31-27(38)33(29(40)35(24)31)19-11-6-3-7-12-19/h2-15,22,24,36H,16-17H2,1H3/t22-,24-/m1/s1 |
| InChIKey | KMIAFVSXRPDWAS-ISKFKSNPSA-N |
| XLogP | 1.41 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|