C37H29ClN4O6 — CID 3374760
13-(3-chlorophenyl)-10-(4-hydroxy-2-methoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 3374760) has the molecular formula C37H29ClN4O6 and a molecular weight of 661.11 g/mol. Its IUPAC name is 13-(3-chlorophenyl)-10-(4-hydroxy-2-methoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | 13-(3-chlorophenyl)-10-(4-hydroxy-2-methoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 3374760 |
| Molecular Formula | C37H29ClN4O6 |
| Molecular Weight | 661.11 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 13-(3-chlorophenyl)-10-(4-hydroxy-2-methoxyphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCn3c(=O)n(-c4ccccc4)c(=O)n3C2CC2C(=O)N(c3cccc(Cl)c3)C(=O)C21c1ccccc1 |
| InChI | InChI=1S/C37H29ClN4O6/c1-48-31-20-26(43)15-16-28(31)32-27-17-18-39-35(46)41(24-12-6-3-7-13-24)36(47)42(39)30(27)21-29-33(44)40(25-14-8-11-23(38)19-25)34(45)37(29,32)22-9-4-2-5-10-22/h2-17,19-20,29-30,32,43H,18,21H2,1H3 |
| InChIKey | MLINXUDQJLOSJE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.11 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|