C37H29ClN4O5 — CID 6640230
(1R,10S,11S,15R)-13-(3-chlorophenyl)-10-(4-hydroxy-3-methylphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone (PubChem CID 6640230) has the molecular formula C37H29ClN4O5 and a molecular weight of 645.12 g/mol. Its IUPAC name is (1R,10S,11S,15R)-13-(3-chlorophenyl)-10-(4-hydroxy-3-methylphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone.
| Compound Name | (1R,10S,11S,15R)-13-(3-chlorophenyl)-10-(4-hydroxy-3-methylphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 6640230 |
| Molecular Formula | C37H29ClN4O5 |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | (1R,10S,11S,15R)-13-(3-chlorophenyl)-10-(4-hydroxy-3-methylphenyl)-4,11-diphenyl-2,4,6,13-tetrazatetracyclo[7.7.0.02,6.011,15]hexadec-8-ene-3,5,12,14-tetrone |
| SMILES | Cc1cc([C@H]2C3=CCn4c(=O)n(-c5ccccc5)c(=O)n4[C@@H]3C[C@H]3C(=O)N(c4cccc(Cl)c4)C(=O)[C@@]23c2ccccc2)ccc1O |
| InChI | InChI=1S/C37H29ClN4O5/c1-22-19-23(15-16-31(22)43)32-28-17-18-39-35(46)41(26-12-6-3-7-13-26)36(47)42(39)30(28)21-29-33(44)40(27-14-8-11-25(38)20-27)34(45)37(29,32)24-9-4-2-5-10-24/h2-17,19-20,29-30,32,43H,18,21H2,1H3/t29-,30+,32-,37+/m0/s1 |
| InChIKey | WCQFMSRYYGPQGV-YEICVTIKSA-N |
| XLogP | 5.26 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|