C39H32BClN2O7 — CID 4099199
[3-[8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 4099199) has the molecular formula C39H32BClN2O7 and a molecular weight of 686.96 g/mol. Its IUPAC name is [3-[8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 4099199 |
| Molecular Formula | C39H32BClN2O7 |
| Molecular Weight | 686.96 g/mol |
| Exact Mass | 686.20 |
| IUPAC Name | [3-[8-(3-chlorophenyl)-6-(4-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(c5cccc(B(O)O)c5)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)ccc1O |
| InChI | InChI=1S/C39H32BClN2O7/c1-21-17-22(13-16-32(21)44)34-28-14-15-29-33(37(47)42(35(29)45)26-11-5-9-24(18-26)40(49)50)30(28)20-31-36(46)43(27-12-6-10-25(41)19-27)38(48)39(31,34)23-7-3-2-4-8-23/h2-14,16-19,29-31,33-34,44,49-50H,15,20H2,1H3 |
| InChIKey | KMSVEPVMOFCHTI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|