C38H29BBrClN2O7 — CID 4065383
[3-[6-(5-bromo-2-hydroxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 4065383) has the molecular formula C38H29BBrClN2O7 and a molecular weight of 751.83 g/mol. Its IUPAC name is [3-[6-(5-bromo-2-hydroxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[6-(5-bromo-2-hydroxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 4065383 |
| Molecular Formula | C38H29BBrClN2O7 |
| Molecular Weight | 751.83 g/mol |
| Exact Mass | 750.09 |
| IUPAC Name | [3-[6-(5-bromo-2-hydroxyphenyl)-8-(3-chlorophenyl)-1,3,7,9-tetraoxo-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3cc(Br)ccc3O)C2C(=O)N1c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C38H29BBrClN2O7/c40-22-12-15-31(44)29(17-22)33-26-13-14-27-32(36(47)42(34(27)45)24-10-4-8-21(16-24)39(49)50)28(26)19-30-35(46)43(25-11-5-9-23(41)18-25)37(48)38(30,33)20-6-2-1-3-7-20/h1-13,15-18,27-28,30,32-33,44,49-50H,14,19H2 |
| InChIKey | CXHMMPXZTVSZRU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|