C39H30Cl2N2O5 — CID 3278780
2-benzyl-6-(5-chloro-2-hydroxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3278780) has the molecular formula C39H30Cl2N2O5 and a molecular weight of 677.58 g/mol. Its IUPAC name is 2-benzyl-6-(5-chloro-2-hydroxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-benzyl-6-(5-chloro-2-hydroxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3278780 |
| Molecular Formula | C39H30Cl2N2O5 |
| Molecular Weight | 677.58 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | 2-benzyl-6-(5-chloro-2-hydroxyphenyl)-8-(3-chlorophenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3cc(Cl)ccc3O)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C39H30Cl2N2O5/c40-24-12-7-13-26(18-24)43-36(46)31-20-29-27(15-16-28-33(29)37(47)42(35(28)45)21-22-8-3-1-4-9-22)34(30-19-25(41)14-17-32(30)44)39(31,38(43)48)23-10-5-2-6-11-23/h1-15,17-19,28-29,31,33-34,44H,16,20-21H2 |
| InChIKey | OHTFOKOKQJYVGR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|