C38H28ClF3N2O6S — CID 4582282
8-(3-chlorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4582282) has the molecular formula C38H28ClF3N2O6S and a molecular weight of 733.16 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4582282 |
| Molecular Formula | C38H28ClF3N2O6S |
| Molecular Weight | 733.16 g/mol |
| Exact Mass | 732.13 |
| IUPAC Name | 8-(3-chlorophenyl)-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3cc(OC(F)(F)F)ccc3O)C2C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C38H28ClF3N2O6S/c39-21-8-4-9-22(16-21)44-34(47)29-18-27-25(12-13-26-31(27)35(48)43(33(26)46)19-24-10-5-15-51-24)32(37(29,36(44)49)20-6-2-1-3-7-20)28-17-23(11-14-30(28)45)50-38(40,41)42/h1-12,14-17,26-27,29,31-32,45H,13,18-19H2 |
| InChIKey | GYSZYAZFBLHHPG-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.16 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|