C39H33ClN2O6S — CID 4548937
8-(3-chlorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4548937) has the molecular formula C39H33ClN2O6S and a molecular weight of 693.22 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4548937 |
| Molecular Formula | C39H33ClN2O6S |
| Molecular Weight | 693.22 g/mol |
| Exact Mass | 692.17 |
| IUPAC Name | 8-(3-chlorophenyl)-6-[4-(2-hydroxyethoxy)phenyl]-6a-phenyl-2-(thiophen-2-ylmethyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccc(OCCO)cc3)C2C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C39H33ClN2O6S/c40-25-8-4-9-26(20-25)42-36(45)32-21-31-29(15-16-30-33(31)37(46)41(35(30)44)22-28-10-5-19-49-28)34(23-11-13-27(14-12-23)48-18-17-43)39(32,38(42)47)24-6-2-1-3-7-24/h1-15,19-20,30-34,43H,16-18,21-22H2 |
| InChIKey | ZTJTWLJHDUZMPZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.22 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|