C45H32ClFN2O6 — CID 5130056
2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5130056) has the molecular formula C45H32ClFN2O6 and a molecular weight of 751.21 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5130056 |
| Molecular Formula | C45H32ClFN2O6 |
| Molecular Weight | 751.21 g/mol |
| Exact Mass | 750.19 |
| IUPAC Name | 2-(4-benzoylphenyl)-8-(3-chlorophenyl)-6-(3-fluoro-4-hydroxyphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C(c1ccccc1)c1ccc(N2C(=O)C3CC=C4C(CC5C(=O)N(c6cccc(Cl)c6)C(=O)C5(c5ccccc5)C4c4ccc(O)c(F)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C45H32ClFN2O6/c46-29-12-7-13-31(23-29)49-42(53)35-24-34-32(39(27-16-21-37(50)36(47)22-27)45(35,44(49)55)28-10-5-2-6-11-28)19-20-33-38(34)43(54)48(41(33)52)30-17-14-26(15-18-30)40(51)25-8-3-1-4-9-25/h1-19,21-23,33-35,38-39,50H,20,24H2 |
| InChIKey | BYFUNLWLCSBRQH-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.21 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|